C13H20F3NO3 — CID 102062047
methyl (2S,4S)-5-methyl-2-prop-2-enyl-4-[(2,2,2-trifluoroacetyl)amino]hexanoate (PubChem CID 102062047) has the molecular formula C13H20F3NO3 and a molecular weight of 295.30 g/mol. Its IUPAC name is methyl (2S,4S)-5-methyl-2-prop-2-enyl-4-[(2,2,2-trifluoroacetyl)amino]hexanoate.
| Compound Name | methyl (2S,4S)-5-methyl-2-prop-2-enyl-4-[(2,2,2-trifluoroacetyl)amino]hexanoate |
|---|---|
| PubChem CID | 102062047 |
| Molecular Formula | C13H20F3NO3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | methyl (2S,4S)-5-methyl-2-prop-2-enyl-4-[(2,2,2-trifluoroacetyl)amino]hexanoate |
| SMILES | C=CC[C@@H](C[C@H](NC(=O)C(F)(F)F)C(C)C)C(=O)OC |
| InChI | InChI=1S/C13H20F3NO3/c1-5-6-9(11(18)20-4)7-10(8(2)3)17-12(19)13(14,15)16/h5,8-10H,1,6-7H2,2-4H3,(H,17,19)/t9-,10-/m0/s1 |
| InChIKey | VILWDNCUUIFLNO-UWVGGRQHSA-N |
| XLogP | 2.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|