C17H29NO2Si2 — CID 102062905
(3S)-1-[bis(trimethylsilyl)methyl]-3-phenylmethoxyazetidin-2-one (PubChem CID 102062905) has the molecular formula C17H29NO2Si2 and a molecular weight of 335.60 g/mol. Its IUPAC name is (3S)-1-[bis(trimethylsilyl)methyl]-3-phenylmethoxyazetidin-2-one.
| Compound Name | (3S)-1-[bis(trimethylsilyl)methyl]-3-phenylmethoxyazetidin-2-one |
|---|---|
| PubChem CID | 102062905 |
| Molecular Formula | C17H29NO2Si2 |
| Molecular Weight | 335.60 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (3S)-1-[bis(trimethylsilyl)methyl]-3-phenylmethoxyazetidin-2-one |
| SMILES | C[Si](C)(C)C(N1C[C@H](OCc2ccccc2)C1=O)[Si](C)(C)C |
| InChI | InChI=1S/C17H29NO2Si2/c1-21(2,3)17(22(4,5)6)18-12-15(16(18)19)20-13-14-10-8-7-9-11-14/h7-11,15,17H,12-13H2,1-6H3/t15-/m0/s1 |
| InChIKey | LAOSEIRBJXYNIK-HNNXBMFYSA-N |
| XLogP | 3.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|