C27H28N2O3 — CID 122233273
(3aS,4S,5S,6S,6aR)-4,5,6-tris(phenylmethoxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrazole (PubChem CID 122233273) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is (3aS,4S,5S,6S,6aR)-4,5,6-tris(phenylmethoxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrazole.
| Compound Name | (3aS,4S,5S,6S,6aR)-4,5,6-tris(phenylmethoxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrazole |
|---|---|
| PubChem CID | 122233273 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | (3aS,4S,5S,6S,6aR)-4,5,6-tris(phenylmethoxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrazole |
| SMILES | c1ccc(CO[C@H]2[C@@H](OCc3ccccc3)[C@H]3CN=N[C@H]3[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H28N2O3/c1-4-10-20(11-5-1)17-30-25-23-16-28-29-24(23)26(31-18-21-12-6-2-7-13-21)27(25)32-19-22-14-8-3-9-15-22/h1-15,23-27H,16-19H2/t23-,24+,25-,26-,27-/m0/s1 |
| InChIKey | UGJNDIVYNCLLFJ-YUDMECHNSA-N |
| XLogP | 5.21 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |