C25H18F3NO4S — CID 10206362
4-[6-methyl-2-oxo-3-[4-(trifluoromethyl)phenyl]pyran-4-yl]-N-phenylbenzenesulfonamide (PubChem CID 10206362) has the molecular formula C25H18F3NO4S and a molecular weight of 485.48 g/mol. Its IUPAC name is 4-[6-methyl-2-oxo-3-[4-(trifluoromethyl)phenyl]pyran-4-yl]-N-phenylbenzenesulfonamide.
| Compound Name | 4-[6-methyl-2-oxo-3-[4-(trifluoromethyl)phenyl]pyran-4-yl]-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 10206362 |
| Molecular Formula | C25H18F3NO4S |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | 4-[6-methyl-2-oxo-3-[4-(trifluoromethyl)phenyl]pyran-4-yl]-N-phenylbenzenesulfonamide |
| SMILES | Cc1cc(-c2ccc(S(=O)(=O)Nc3ccccc3)cc2)c(-c2ccc(C(F)(F)F)cc2)c(=O)o1 |
| InChI | InChI=1S/C25H18F3NO4S/c1-16-15-22(23(24(30)33-16)18-7-11-19(12-8-18)25(26,27)28)17-9-13-21(14-10-17)34(31,32)29-20-5-3-2-4-6-20/h2-15,29H,1H3 |
| InChIKey | MFLAXQUSHBAVBS-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |