C24H19N4O2+ — CID 102064093
2-[4-[(1E,3E,5E)-6-(4-nitrophenyl)hexa-1,3,5-trienyl]pyridin-1-ium-1-yl]-1H-benzimidazole (PubChem CID 102064093) has the molecular formula C24H19N4O2+ and a molecular weight of 395.44 g/mol. Its IUPAC name is 2-[4-[(1E,3E,5E)-6-(4-nitrophenyl)hexa-1,3,5-trienyl]pyridin-1-ium-1-yl]-1H-benzimidazole.
| Compound Name | 2-[4-[(1E,3E,5E)-6-(4-nitrophenyl)hexa-1,3,5-trienyl]pyridin-1-ium-1-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 102064093 |
| Molecular Formula | C24H19N4O2+ |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-[4-[(1E,3E,5E)-6-(4-nitrophenyl)hexa-1,3,5-trienyl]pyridin-1-ium-1-yl]-1H-benzimidazole |
| SMILES | O=[N+]([O-])c1ccc(/C=C/C=C/C=C/c2cc[n+](-c3nc4ccccc4[nH]3)cc2)cc1 |
| InChI | InChI=1S/C24H19N4O2/c29-28(30)21-13-11-19(12-14-21)7-3-1-2-4-8-20-15-17-27(18-16-20)24-25-22-9-5-6-10-23(22)26-24/h1-18H,(H,25,26)/q+1/b2-1+,7-3+,8-4+ |
| InChIKey | ZJCBTPGVOAJHET-SQSUNLSESA-N |
| XLogP | 5.03 |
| TPSA | 75.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|