C26H24N2O8 — CID 102065319
1-[3-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)phenoxy]ethoxy]ethoxy]ethoxy]phenyl]pyrrole-2,5-dione (PubChem CID 102065319) has the molecular formula C26H24N2O8 and a molecular weight of 492.48 g/mol. Its IUPAC name is 1-[3-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)phenoxy]ethoxy]ethoxy]ethoxy]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[3-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)phenoxy]ethoxy]ethoxy]ethoxy]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 102065319 |
| Molecular Formula | C26H24N2O8 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 1-[3-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)phenoxy]ethoxy]ethoxy]ethoxy]phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1cccc(OCCOCCOCCOc2cccc(N3C(=O)C=CC3=O)c2)c1 |
| InChI | InChI=1S/C26H24N2O8/c29-23-7-8-24(30)27(23)19-3-1-5-21(17-19)35-15-13-33-11-12-34-14-16-36-22-6-2-4-20(18-22)28-25(31)9-10-26(28)32/h1-10,17-18H,11-16H2 |
| InChIKey | QHPJVZUBZMZLDA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|