C11H6N2O3 — CID 19967611
[3-(2,5-dioxopyrrol-1-yl)phenyl] cyanate (PubChem CID 19967611) has the molecular formula C11H6N2O3 and a molecular weight of 214.18 g/mol. Its IUPAC name is [3-(2,5-dioxopyrrol-1-yl)phenyl] cyanate.
| Compound Name | [3-(2,5-dioxopyrrol-1-yl)phenyl] cyanate |
|---|---|
| PubChem CID | 19967611 |
| Molecular Formula | C11H6N2O3 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | [3-(2,5-dioxopyrrol-1-yl)phenyl] cyanate |
| SMILES | N#COc1cccc(N2C(=O)C=CC2=O)c1 |
| InChI | InChI=1S/C11H6N2O3/c12-7-16-9-3-1-2-8(6-9)13-10(14)4-5-11(13)15/h1-6H |
| InChIKey | LWZKCXLVVVFGSC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|