C12H9NO6S — CID 142806173
1-[3-[methoxy-oxo-(oxomethylidene)-λ6-sulfanyl]oxyphenyl]pyrrole-2,5-dione (PubChem CID 142806173) has the molecular formula C12H9NO6S and a molecular weight of 295.27 g/mol. Its IUPAC name is 1-[3-[methoxy-oxo-(oxomethylidene)-λ6-sulfanyl]oxyphenyl]pyrrole-2,5-dione.
| Compound Name | 1-[3-[methoxy-oxo-(oxomethylidene)-λ6-sulfanyl]oxyphenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 142806173 |
| Molecular Formula | C12H9NO6S |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 1-[3-[methoxy-oxo-(oxomethylidene)-λ6-sulfanyl]oxyphenyl]pyrrole-2,5-dione |
| SMILES | COS(=O)(=C=O)Oc1cccc(N2C(=O)C=CC2=O)c1 |
| InChI | InChI=1S/C12H9NO6S/c1-18-20(17,8-14)19-10-4-2-3-9(7-10)13-11(15)5-6-12(13)16/h2-7H,1H3 |
| InChIKey | SOBNRCLWWANYOS-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|