C27H18N2O6 — CID 141170078
1-[3-[[3-(2,5-dioxopyrrol-1-yl)phenoxy]-phenylmethoxy]phenyl]pyrrole-2,5-dione (PubChem CID 141170078) has the molecular formula C27H18N2O6 and a molecular weight of 466.45 g/mol. Its IUPAC name is 1-[3-[[3-(2,5-dioxopyrrol-1-yl)phenoxy]-phenylmethoxy]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[3-[[3-(2,5-dioxopyrrol-1-yl)phenoxy]-phenylmethoxy]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 141170078 |
| Molecular Formula | C27H18N2O6 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 1-[3-[[3-(2,5-dioxopyrrol-1-yl)phenoxy]-phenylmethoxy]phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1cccc(OC(Oc2cccc(N3C(=O)C=CC3=O)c2)c2ccccc2)c1 |
| InChI | InChI=1S/C27H18N2O6/c30-23-12-13-24(31)28(23)19-8-4-10-21(16-19)34-27(18-6-2-1-3-7-18)35-22-11-5-9-20(17-22)29-25(32)14-15-26(29)33/h1-17,27H |
| InChIKey | RKVRRCFVXTZULN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|