C35H20F6N2O6 — CID 90266287
1-[3-[2-[3-[2-[3-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]-1,1,2,2,3,3-hexafluoropropyl]phenoxy]phenyl]pyrrole-2,5-dione (PubChem CID 90266287) has the molecular formula C35H20F6N2O6 and a molecular weight of 678.54 g/mol. Its IUPAC name is 1-[3-[2-[3-[2-[3-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]-1,1,2,2,3,3-hexafluoropropyl]phenoxy]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[3-[2-[3-[2-[3-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]-1,1,2,2,3,3-hexafluoropropyl]phenoxy]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 90266287 |
| Molecular Formula | C35H20F6N2O6 |
| Molecular Weight | 678.54 g/mol |
| Exact Mass | 678.12 |
| IUPAC Name | 1-[3-[2-[3-[2-[3-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]-1,1,2,2,3,3-hexafluoropropyl]phenoxy]phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1cccc(Oc2ccccc2C(F)(F)C(F)(F)C(F)(F)c2ccccc2Oc2cccc(N3C(=O)C=CC3=O)c2)c1 |
| InChI | InChI=1S/C35H20F6N2O6/c36-33(37,25-11-1-3-13-27(25)48-23-9-5-7-21(19-23)42-29(44)15-16-30(42)45)35(40,41)34(38,39)26-12-2-4-14-28(26)49-24-10-6-8-22(20-24)43-31(46)17-18-32(43)47/h1-20H |
| InChIKey | MKVHDYHYZQUFCT-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.54 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|