C36H28N2O6 — CID 19913173
1-[3-[4-[2-[4-[3-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]butan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione (PubChem CID 19913173) has the molecular formula C36H28N2O6 and a molecular weight of 584.63 g/mol. Its IUPAC name is 1-[3-[4-[2-[4-[3-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]butan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[3-[4-[2-[4-[3-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]butan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 19913173 |
| Molecular Formula | C36H28N2O6 |
| Molecular Weight | 584.63 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | 1-[3-[4-[2-[4-[3-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]butan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione |
| SMILES | CCC(C)(c1ccc(Oc2cccc(N3C(=O)C=CC3=O)c2)cc1)c1ccc(Oc2cccc(N3C(=O)C=CC3=O)c2)cc1 |
| InChI | InChI=1S/C36H28N2O6/c1-3-36(2,24-10-14-28(15-11-24)43-30-8-4-6-26(22-30)37-32(39)18-19-33(37)40)25-12-16-29(17-13-25)44-31-9-5-7-27(23-31)38-34(41)20-21-35(38)42/h4-23H,3H2,1-2H3 |
| InChIKey | TZMMMLIFBVCSKD-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.63 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|