C12H10N4OS2 — CID 102066972
5-(1H-benzimidazol-2-ylsulfanyl)-6-methyl-2-sulfanylidene-1H-pyrimidin-4-one (PubChem CID 102066972) has the molecular formula C12H10N4OS2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 5-(1H-benzimidazol-2-ylsulfanyl)-6-methyl-2-sulfanylidene-1H-pyrimidin-4-one.
| Compound Name | 5-(1H-benzimidazol-2-ylsulfanyl)-6-methyl-2-sulfanylidene-1H-pyrimidin-4-one |
|---|---|
| PubChem CID | 102066972 |
| Molecular Formula | C12H10N4OS2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 5-(1H-benzimidazol-2-ylsulfanyl)-6-methyl-2-sulfanylidene-1H-pyrimidin-4-one |
| SMILES | Cc1[nH]c(=S)[nH]c(=O)c1Sc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C12H10N4OS2/c1-6-9(10(17)16-11(18)13-6)19-12-14-7-4-2-3-5-8(7)15-12/h2-5H,1H3,(H,14,15)(H2,13,16,17,18) |
| InChIKey | XVWLXFGQRQOILT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|