C19H27BO2 — CID 102067404
4-methyl-5-phenyl-2-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,3,2-dioxaborolane (PubChem CID 102067404) has the molecular formula C19H27BO2 and a molecular weight of 298.24 g/mol. Its IUPAC name is 4-methyl-5-phenyl-2-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,3,2-dioxaborolane.
| Compound Name | 4-methyl-5-phenyl-2-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102067404 |
| Molecular Formula | C19H27BO2 |
| Molecular Weight | 298.24 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 4-methyl-5-phenyl-2-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,3,2-dioxaborolane |
| SMILES | CC1OB([C@@H]2C[C@@H]3C[C@H]([C@H]2C)C3(C)C)OC1c1ccccc1 |
| InChI | InChI=1S/C19H27BO2/c1-12-16-10-15(19(16,3)4)11-17(12)20-21-13(2)18(22-20)14-8-6-5-7-9-14/h5-9,12-13,15-18H,10-11H2,1-4H3/t12-,13?,15+,16-,17-,18?/m1/s1 |
| InChIKey | LDAPYZFXXSNKBS-ONGGNSLKSA-N |
| XLogP | 4.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.24 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|