C22H39BO3 — CID 10428709
(6S)-6-[4-(1,3-dioxan-2-yl)butyl]-2-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]oxaborinane (PubChem CID 10428709) has the molecular formula C22H39BO3 and a molecular weight of 362.36 g/mol. Its IUPAC name is (6S)-6-[4-(1,3-dioxan-2-yl)butyl]-2-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]oxaborinane.
| Compound Name | (6S)-6-[4-(1,3-dioxan-2-yl)butyl]-2-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]oxaborinane |
|---|---|
| PubChem CID | 10428709 |
| Molecular Formula | C22H39BO3 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.30 |
| IUPAC Name | (6S)-6-[4-(1,3-dioxan-2-yl)butyl]-2-[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]oxaborinane |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1B1CCC[C@@H](CCCCC3OCCCO3)O1)C2(C)C |
| InChI | InChI=1S/C22H39BO3/c1-16-19-14-17(22(19,2)3)15-20(16)23-11-6-9-18(26-23)8-4-5-10-21-24-12-7-13-25-21/h16-21H,4-15H2,1-3H3/t16-,17+,18-,19-,20-/m1/s1 |
| InChIKey | VLTWKJSGISWUKO-USYVTKNRSA-N |
| XLogP | 5.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|