C26H40O6Si — CID 102067951
tert-butyl (3S)-4-[1-[tert-butyl(dimethyl)silyl]oxy-4,5-dimethoxynaphthalen-2-yl]-3-hydroxybutanoate (PubChem CID 102067951) has the molecular formula C26H40O6Si and a molecular weight of 476.69 g/mol. Its IUPAC name is tert-butyl (3S)-4-[1-[tert-butyl(dimethyl)silyl]oxy-4,5-dimethoxynaphthalen-2-yl]-3-hydroxybutanoate.
| Compound Name | tert-butyl (3S)-4-[1-[tert-butyl(dimethyl)silyl]oxy-4,5-dimethoxynaphthalen-2-yl]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 102067951 |
| Molecular Formula | C26H40O6Si |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | tert-butyl (3S)-4-[1-[tert-butyl(dimethyl)silyl]oxy-4,5-dimethoxynaphthalen-2-yl]-3-hydroxybutanoate |
| SMILES | COc1cccc2c(O[Si](C)(C)C(C)(C)C)c(C[C@H](O)CC(=O)OC(C)(C)C)cc(OC)c12 |
| InChI | InChI=1S/C26H40O6Si/c1-25(2,3)31-22(28)16-18(27)14-17-15-21(30-8)23-19(12-11-13-20(23)29-7)24(17)32-33(9,10)26(4,5)6/h11-13,15,18,27H,14,16H2,1-10H3/t18-/m0/s1 |
| InChIKey | BJVFGVPLZVXYNV-SFHVURJKSA-N |
| XLogP | 5.88 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|