C27H26O2 — CID 102069160
(2R)-2-[(1R)-3-oxo-1,3-diphenylpropyl]-2-phenylcyclohexan-1-one (PubChem CID 102069160) has the molecular formula C27H26O2 and a molecular weight of 382.50 g/mol. Its IUPAC name is (2R)-2-[(1R)-3-oxo-1,3-diphenylpropyl]-2-phenylcyclohexan-1-one.
| Compound Name | (2R)-2-[(1R)-3-oxo-1,3-diphenylpropyl]-2-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 102069160 |
| Molecular Formula | C27H26O2 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | (2R)-2-[(1R)-3-oxo-1,3-diphenylpropyl]-2-phenylcyclohexan-1-one |
| SMILES | O=C(C[C@H](c1ccccc1)[C@@]1(c2ccccc2)CCCCC1=O)c1ccccc1 |
| InChI | InChI=1S/C27H26O2/c28-25(22-14-6-2-7-15-22)20-24(21-12-4-1-5-13-21)27(19-11-10-18-26(27)29)23-16-8-3-9-17-23/h1-9,12-17,24H,10-11,18-20H2/t24-,27+/m1/s1 |
| InChIKey | QSVBQOIXXKRILW-SQHAQQRYSA-N |
| XLogP | 6.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |