C14H14O4 — CID 102358186
2-hydroxy-2-phenacylcyclohexane-1,3-dione (PubChem CID 102358186) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is 2-hydroxy-2-phenacylcyclohexane-1,3-dione.
| Compound Name | 2-hydroxy-2-phenacylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 102358186 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-hydroxy-2-phenacylcyclohexane-1,3-dione |
| SMILES | O=C(CC1(O)C(=O)CCCC1=O)c1ccccc1 |
| InChI | InChI=1S/C14H14O4/c15-11(10-5-2-1-3-6-10)9-14(18)12(16)7-4-8-13(14)17/h1-3,5-6,18H,4,7-9H2 |
| InChIKey | IWMWIPAFFYTOSX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|