C85H143NO11 — CID 102069172
2-[(3,4-didecoxybenzoyl)-[2-(3,4-didecoxybenzoyl)oxyethyl]amino]ethyl 3,4-didecoxybenzoate (PubChem CID 102069172) has the molecular formula C85H143NO11 and a molecular weight of 1355.07 g/mol. Its IUPAC name is 2-[(3,4-didecoxybenzoyl)-[2-(3,4-didecoxybenzoyl)oxyethyl]amino]ethyl 3,4-didecoxybenzoate.
| Compound Name | 2-[(3,4-didecoxybenzoyl)-[2-(3,4-didecoxybenzoyl)oxyethyl]amino]ethyl 3,4-didecoxybenzoate |
|---|---|
| PubChem CID | 102069172 |
| Molecular Formula | C85H143NO11 |
| Molecular Weight | 1355.07 g/mol |
| Exact Mass | 1354.07 |
| IUPAC Name | 2-[(3,4-didecoxybenzoyl)-[2-(3,4-didecoxybenzoyl)oxyethyl]amino]ethyl 3,4-didecoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)OCCN(CCOC(=O)c2ccc(OCCCCCCCCCC)c(OCCCCCCCCCC)c2)C(=O)c2ccc(OCCCCCCCCCC)c(OCCCCCCCCCC)c2)cc1OCCCCCCCCCC |
| InChI | InChI=1S/C85H143NO11/c1-7-13-19-25-31-37-43-49-63-90-77-58-55-74(71-80(77)93-66-52-46-40-34-28-22-16-10-4)83(87)86(61-69-96-84(88)75-56-59-78(91-64-50-44-38-32-26-20-14-8-2)81(72-75)94-67-53-47-41-35-29-23-17-11-5)62-70-97-85(89)76-57-60-79(92-65-51-45-39-33-27-21-15-9-3)82(73-76)95-68-54-48-42-36-30-24-18-12-6/h55-60,71-73H,7-54,61-70H2,1-6H3 |
| InChIKey | ISTWNNJPDRKRHJ-UHFFFAOYSA-N |
| XLogP | 24.96 |
| TPSA | 128.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 69 |
| Heavy Atoms | 97 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1355.07 |
| LogP ≤ 5 | 24.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|