C16H26O2 — CID 102073162
cis-(1S,2S)-1-(1-ethoxyethenyl)-1-prop-2-enoxy-2-prop-1-en-2-ylcyclohexane (PubChem CID 102073162) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is cis-(1S,2S)-1-(1-ethoxyethenyl)-1-prop-2-enoxy-2-prop-1-en-2-ylcyclohexane.
| Compound Name | cis-(1S,2S)-1-(1-ethoxyethenyl)-1-prop-2-enoxy-2-prop-1-en-2-ylcyclohexane |
|---|---|
| PubChem CID | 102073162 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | cis-(1S,2S)-1-(1-ethoxyethenyl)-1-prop-2-enoxy-2-prop-1-en-2-ylcyclohexane |
| SMILES | C=CCO[C@@]1(C(=C)OCC)CCCC[C@H]1C(=C)C |
| InChI | InChI=1S/C16H26O2/c1-6-12-18-16(14(5)17-7-2)11-9-8-10-15(16)13(3)4/h6,15H,1,3,5,7-12H2,2,4H3/t15-,16+/m0/s1 |
| InChIKey | MEQYNOHAZQSDJF-JKSUJKDBSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|