C44H64O8Si8 — CID 102074522
trimethyl-[[2,4,6,8-tetrakis(4-ethenylphenyl)-4,6,8-tris(trimethylsilyloxy)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]oxy]silane (PubChem CID 102074522) has the molecular formula C44H64O8Si8 and a molecular weight of 945.68 g/mol. Its IUPAC name is trimethyl-[[2,4,6,8-tetrakis(4-ethenylphenyl)-4,6,8-tris(trimethylsilyloxy)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]oxy]silane.
| Compound Name | trimethyl-[[2,4,6,8-tetrakis(4-ethenylphenyl)-4,6,8-tris(trimethylsilyloxy)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]oxy]silane |
|---|---|
| PubChem CID | 102074522 |
| Molecular Formula | C44H64O8Si8 |
| Molecular Weight | 945.68 g/mol |
| Exact Mass | 944.28 |
| IUPAC Name | trimethyl-[[2,4,6,8-tetrakis(4-ethenylphenyl)-4,6,8-tris(trimethylsilyloxy)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]oxy]silane |
| SMILES | C=Cc1ccc([Si]2(O[Si](C)(C)C)O[Si](O[Si](C)(C)C)(c3ccc(C=C)cc3)O[Si](O[Si](C)(C)C)(c3ccc(C=C)cc3)O[Si](O[Si](C)(C)C)(c3ccc(C=C)cc3)O2)cc1 |
| InChI | InChI=1S/C44H64O8Si8/c1-17-37-21-29-41(30-22-37)57(45-53(5,6)7)49-58(46-54(8,9)10,42-31-23-38(18-2)24-32-42)51-60(48-56(14,15)16,44-35-27-40(20-4)28-36-44)52-59(50-57,47-55(11,12)13)43-33-25-39(19-3)26-34-43/h17-36H,1-4H2,5-16H3 |
| InChIKey | QZUXBYLWMQDLQH-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.68 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|