C18H18N6 — CID 102075852
2-(2-pentyltetrazol-5-yl)-1,10-phenanthroline (PubChem CID 102075852) has the molecular formula C18H18N6 and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-(2-pentyltetrazol-5-yl)-1,10-phenanthroline.
| Compound Name | 2-(2-pentyltetrazol-5-yl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 102075852 |
| Molecular Formula | C18H18N6 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2-(2-pentyltetrazol-5-yl)-1,10-phenanthroline |
| SMILES | CCCCCn1nnc(-c2ccc3ccc4cccnc4c3n2)n1 |
| InChI | InChI=1S/C18H18N6/c1-2-3-4-12-24-22-18(21-23-24)15-10-9-14-8-7-13-6-5-11-19-16(13)17(14)20-15/h5-11H,2-4,12H2,1H3 |
| InChIKey | ANMOJETWEHDYGY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|