C26H46N4-2 — CID 102076123
2,2-dimethylpropyl-[4-(2,2-dimethylpropylazanidyl)-3,6-bis(2,2-dimethylpropylimino)cyclohexa-1,4-dien-1-yl]azanide (PubChem CID 102076123) has the molecular formula C26H46N4-2 and a molecular weight of 414.68 g/mol. Its IUPAC name is 2,2-dimethylpropyl-[4-(2,2-dimethylpropylazanidyl)-3,6-bis(2,2-dimethylpropylimino)cyclohexa-1,4-dien-1-yl]azanide.
| Compound Name | 2,2-dimethylpropyl-[4-(2,2-dimethylpropylazanidyl)-3,6-bis(2,2-dimethylpropylimino)cyclohexa-1,4-dien-1-yl]azanide |
|---|---|
| PubChem CID | 102076123 |
| Molecular Formula | C26H46N4-2 |
| Molecular Weight | 414.68 g/mol |
| Exact Mass | 414.37 |
| IUPAC Name | 2,2-dimethylpropyl-[4-(2,2-dimethylpropylazanidyl)-3,6-bis(2,2-dimethylpropylimino)cyclohexa-1,4-dien-1-yl]azanide |
| SMILES | CC(C)(C)C/N=C1\C=C([N-]CC(C)(C)C)/C(=N/CC(C)(C)C)C=C1[N-]CC(C)(C)C |
| InChI | InChI=1S/C26H46N4/c1-23(2,3)15-27-19-13-21(29-17-25(7,8)9)22(30-18-26(10,11)12)14-20(19)28-16-24(4,5)6/h13-14H,15-18H2,1-12H3/q-2/b27-19+,30-22+ |
| InChIKey | IGVYSPADNFWLAV-ABJZCIPVSA-N |
| XLogP | 7.58 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.68 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|