C21H34N2O3 — CID 102078979
2-[2,2-bis[di(propan-2-yl)amino]acetyl]benzoic acid (PubChem CID 102078979) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is 2-[2,2-bis[di(propan-2-yl)amino]acetyl]benzoic acid.
| Compound Name | 2-[2,2-bis[di(propan-2-yl)amino]acetyl]benzoic acid |
|---|---|
| PubChem CID | 102078979 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | 2-[2,2-bis[di(propan-2-yl)amino]acetyl]benzoic acid |
| SMILES | CC(C)N(C(C)C)C(C(=O)c1ccccc1C(=O)O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C21H34N2O3/c1-13(2)22(14(3)4)20(23(15(5)6)16(7)8)19(24)17-11-9-10-12-18(17)21(25)26/h9-16,20H,1-8H3,(H,25,26) |
| InChIKey | RFOAIYYNWTYWSU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|