C50H48N8O8S2 — CID 102079497
4,27-bis[[2-(6-pyridin-2-yl-2-pyridinyl)-1,3-thiazol-4-yl]methoxymethyl]-8,11,14,17,20,23-hexaoxa-3,28-diazatricyclo[22.4.0.02,7]octacosa-1(24),2(7),3,5,25,27-hexaene (PubChem CID 102079497) has the molecular formula C50H48N8O8S2 and a molecular weight of 953.12 g/mol. Its IUPAC name is 4,27-bis[[2-(6-pyridin-2-yl-2-pyridinyl)-1,3-thiazol-4-yl]methoxymethyl]-8,11,14,17,20,23-hexaoxa-3,28-diazatricyclo[22.4.0.02,7]octacosa-1(24),2(7),3,5,25,27-hexaene.
| Compound Name | 4,27-bis[[2-(6-pyridin-2-yl-2-pyridinyl)-1,3-thiazol-4-yl]methoxymethyl]-8,11,14,17,20,23-hexaoxa-3,28-diazatricyclo[22.4.0.02,7]octacosa-1(24),2(7),3,5,25,27-hexaene |
|---|---|
| PubChem CID | 102079497 |
| Molecular Formula | C50H48N8O8S2 |
| Molecular Weight | 953.12 g/mol |
| Exact Mass | 952.30 |
| IUPAC Name | 4,27-bis[[2-(6-pyridin-2-yl-2-pyridinyl)-1,3-thiazol-4-yl]methoxymethyl]-8,11,14,17,20,23-hexaoxa-3,28-diazatricyclo[22.4.0.02,7]octacosa-1(24),2(7),3,5,25,27-hexaene |
| SMILES | c1ccc(-c2cccc(-c3nc(COCc4ccc5c(n4)-c4nc(COCc6csc(-c7cccc(-c8ccccn8)n7)n6)ccc4OCCOCCOCCOCCOCCO5)cs3)n2)nc1 |
| InChI | InChI=1S/C50H48N8O8S2/c1-3-17-51-39(7-1)41-9-5-11-43(57-41)49-55-37(33-67-49)31-63-29-35-13-15-45-47(53-35)48-46(66-28-26-62-24-22-60-20-19-59-21-23-61-25-27-65-45)16-14-36(54-48)30-64-32-38-34-68-50(56-38)44-12-6-10-42(58-44)40-8-2-4-18-52-40/h1-18,33-34H,19-32H2 |
| InChIKey | XJNUEPFCGWCSKE-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 176.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.12 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |