C45H40N4O5S2 — CID 102161235
4-pyridin-2-yl-2-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-[(6-pyridin-2-yl-2-pyridinyl)oxymethyl]oxan-2-yl]sulfanyl-1,3-thiazole (PubChem CID 102161235) has the molecular formula C45H40N4O5S2 and a molecular weight of 780.97 g/mol. Its IUPAC name is 4-pyridin-2-yl-2-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-[(6-pyridin-2-yl-2-pyridinyl)oxymethyl]oxan-2-yl]sulfanyl-1,3-thiazole.
| Compound Name | 4-pyridin-2-yl-2-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-[(6-pyridin-2-yl-2-pyridinyl)oxymethyl]oxan-2-yl]sulfanyl-1,3-thiazole |
|---|---|
| PubChem CID | 102161235 |
| Molecular Formula | C45H40N4O5S2 |
| Molecular Weight | 780.97 g/mol |
| Exact Mass | 780.24 |
| IUPAC Name | 4-pyridin-2-yl-2-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-[(6-pyridin-2-yl-2-pyridinyl)oxymethyl]oxan-2-yl]sulfanyl-1,3-thiazole |
| SMILES | c1ccc(CO[C@@H]2[C@@H](OCc3ccccc3)[C@H](Sc3nc(-c4ccccn4)cs3)O[C@H](COc3cccc(-c4ccccn4)n3)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C45H40N4O5S2/c1-4-15-32(16-5-1)27-51-41-39(30-50-40-24-14-23-37(48-40)35-21-10-12-25-46-35)54-44(56-45-49-38(31-55-45)36-22-11-13-26-47-36)43(53-29-34-19-8-3-9-20-34)42(41)52-28-33-17-6-2-7-18-33/h1-26,31,39,41-44H,27-30H2/t39-,41-,42+,43-,44+/m1/s1 |
| InChIKey | JEEVHVPTGWGSNH-ZCCIZBBCSA-N |
| XLogP | 9.31 |
| TPSA | 97.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.97 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |