C16H30N2O5 — CID 102080452
methyl 5-[5-[hydroxy(3-methylbutanoyl)amino]pentylamino]-5-oxopentanoate (PubChem CID 102080452) has the molecular formula C16H30N2O5 and a molecular weight of 330.43 g/mol. Its IUPAC name is methyl 5-[5-[hydroxy(3-methylbutanoyl)amino]pentylamino]-5-oxopentanoate.
| Compound Name | methyl 5-[5-[hydroxy(3-methylbutanoyl)amino]pentylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 102080452 |
| Molecular Formula | C16H30N2O5 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | methyl 5-[5-[hydroxy(3-methylbutanoyl)amino]pentylamino]-5-oxopentanoate |
| SMILES | COC(=O)CCCC(=O)NCCCCCN(O)C(=O)CC(C)C |
| InChI | InChI=1S/C16H30N2O5/c1-13(2)12-15(20)18(22)11-6-4-5-10-17-14(19)8-7-9-16(21)23-3/h13,22H,4-12H2,1-3H3,(H,17,19) |
| InChIKey | VKKQUUFNKVYIMI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|