C24H29NO3 — CID 102081555
methyl 2-(4-benzoyl-1-benzyl-5-ethylpiperidin-3-yl)acetate (PubChem CID 102081555) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is methyl 2-(4-benzoyl-1-benzyl-5-ethylpiperidin-3-yl)acetate.
| Compound Name | methyl 2-(4-benzoyl-1-benzyl-5-ethylpiperidin-3-yl)acetate |
|---|---|
| PubChem CID | 102081555 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | methyl 2-(4-benzoyl-1-benzyl-5-ethylpiperidin-3-yl)acetate |
| SMILES | CCC1CN(Cc2ccccc2)CC(CC(=O)OC)C1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H29NO3/c1-3-19-16-25(15-18-10-6-4-7-11-18)17-21(14-22(26)28-2)23(19)24(27)20-12-8-5-9-13-20/h4-13,19,21,23H,3,14-17H2,1-2H3 |
| InChIKey | QCWZQOMZGILWDA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |