methyl 2-(4-benzoyl-1-benzyl-5-ethylpiperidin-3-yl)acetate

C24H29NO3 — CID 102081555

IUPACmethyl 2-(4-benzoyl-1-benzyl-5-ethylpiperidin-3-yl)acetate
SMILESCCC1CN(Cc2ccccc2)CC(CC(=O)OC)C1C(=O)c1ccccc1
InChIInChI=1S/C24H29NO3/c1-3-19-16-25(15-18-10-6-4-7-11-18)17-21(14-22(26)28-2)23(19)24(27)20-12-8-5-9-13-20/h4-13,19,21,23H,3,14-17H2,1-2H3
InChIKeyQCWZQOMZGILWDA-UHFFFAOYSA-N
MW379.50 g/mol
LogP4.21
Rot. Bonds7

About methyl 2-(4-benzoyl-1-benzyl-5-ethylpiperidin-3-yl)acetate

methyl 2-(4-benzoyl-1-benzyl-5-ethylpiperidin-3-yl)acetate (PubChem CID 102081555) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is methyl 2-(4-benzoyl-1-benzyl-5-ethylpiperidin-3-yl)acetate.

Molecular Properties

Compound Namemethyl 2-(4-benzoyl-1-benzyl-5-ethylpiperidin-3-yl)acetate
PubChem CID102081555
Molecular FormulaC24H29NO3
Molecular Weight379.50 g/mol
Exact Mass379.21
IUPAC Namemethyl 2-(4-benzoyl-1-benzyl-5-ethylpiperidin-3-yl)acetate
SMILESCCC1CN(Cc2ccccc2)CC(CC(=O)OC)C1C(=O)c1ccccc1
InChIInChI=1S/C24H29NO3/c1-3-19-16-25(15-18-10-6-4-7-11-18)17-21(14-22(26)28-2)23(19)24(27)20-12-8-5-9-13-20/h4-13,19,21,23H,3,14-17H2,1-2H3
InChIKeyQCWZQOMZGILWDA-UHFFFAOYSA-N
XLogP4.21
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms28
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500379.50
LogP ≤ 54.21
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-(4-benzoyl-1-benzyl-5-ethylpiperidin-3-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(4-benzoyl-1-benzyl-5-ethylpiperidin-3-yl)acetate?
The IUPAC name of methyl 2-(4-benzoyl-1-benzyl-5-ethylpiperidin-3-yl)acetate (CID 102081555) is methyl 2-(4-benzoyl-1-benzyl-5-ethylpiperidin-3-yl)acetate.
What is the SMILES notation for methyl 2-(4-benzoyl-1-benzyl-5-ethylpiperidin-3-yl)acetate?
The canonical SMILES for methyl 2-(4-benzoyl-1-benzyl-5-ethylpiperidin-3-yl)acetate is CCC1CN(Cc2ccccc2)CC(CC(=O)OC)C1C(=O)c1ccccc1.
What is the InChIKey of methyl 2-(4-benzoyl-1-benzyl-5-ethylpiperidin-3-yl)acetate?
The InChIKey is QCWZQOMZGILWDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29NO3/c1-3-19-16-25(15-18-10-6-4-7-11-18)17-21(14-22(26)28-2)23(19)24(27)20-12-8-5-9-13-20/h4-13,19,21,23H,3,14-17H2,1-2H3.
What are the key properties of methyl 2-(4-benzoyl-1-benzyl-5-ethylpiperidin-3-yl)acetate?
methyl 2-(4-benzoyl-1-benzyl-5-ethylpiperidin-3-yl)acetate has a molecular weight of 379.50 g/mol, XLogP of 4.21, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-benzoyl-1-benzyl-5-ethylpiperidin-3-yl)acetate is sourced from PubChem (CID 102081555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).