C8H13F3Si2 — CID 102081791
trifluoro-(1-trimethylsilylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 102081791) has the molecular formula C8H13F3Si2 and a molecular weight of 222.36 g/mol. Its IUPAC name is trifluoro-(1-trimethylsilylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | trifluoro-(1-trimethylsilylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 102081791 |
| Molecular Formula | C8H13F3Si2 |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | trifluoro-(1-trimethylsilylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | C[Si](C)(C)C1([Si](F)(F)F)C=CC=C1 |
| InChI | InChI=1S/C8H13F3Si2/c1-12(2,3)8(13(9,10)11)6-4-5-7-8/h4-7H,1-3H3 |
| InChIKey | RSSONPUODZWQSQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|