C7H7BrN2 — CID 102084909
3-bromo-1,5-dimethylpyrrole-2-carbonitrile (PubChem CID 102084909) has the molecular formula C7H7BrN2 and a molecular weight of 199.05 g/mol. Its IUPAC name is 3-bromo-1,5-dimethylpyrrole-2-carbonitrile.
| Compound Name | 3-bromo-1,5-dimethylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 102084909 |
| Molecular Formula | C7H7BrN2 |
| Molecular Weight | 199.05 g/mol |
| Exact Mass | 197.98 |
| IUPAC Name | 3-bromo-1,5-dimethylpyrrole-2-carbonitrile |
| SMILES | Cc1cc(Br)c(C#N)n1C |
| InChI | InChI=1S/C7H7BrN2/c1-5-3-6(8)7(4-9)10(5)2/h3H,1-2H3 |
| InChIKey | RQDNTEQSLSUUEU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.05 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |