C11H11Br2N3 — CID 170759913
5,6-dibromo-2-methylindazole-3-carbonitrile;ethane (PubChem CID 170759913) has the molecular formula C11H11Br2N3 and a molecular weight of 345.04 g/mol. Its IUPAC name is 5,6-dibromo-2-methylindazole-3-carbonitrile;ethane.
| Compound Name | 5,6-dibromo-2-methylindazole-3-carbonitrile;ethane |
|---|---|
| PubChem CID | 170759913 |
| Molecular Formula | C11H11Br2N3 |
| Molecular Weight | 345.04 g/mol |
| Exact Mass | 342.93 |
| IUPAC Name | 5,6-dibromo-2-methylindazole-3-carbonitrile;ethane |
| SMILES | CC.Cn1nc2cc(Br)c(Br)cc2c1C#N |
| InChI | InChI=1S/C9H5Br2N3.C2H6/c1-14-9(4-12)5-2-6(10)7(11)3-8(5)13-14;1-2/h2-3H,1H3;1-2H3 |
| InChIKey | WYNYVBRROCRYIY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.04 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |