C26H26Cl2N4O4 — CID 10208637
6-chloro-3'-[3-(6-chloro-2-oxospiro[1H-3,1-benzoxazine-4,4'-piperidine]-1'-yl)propyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione (PubChem CID 10208637) has the molecular formula C26H26Cl2N4O4 and a molecular weight of 529.42 g/mol. Its IUPAC name is 6-chloro-3'-[3-(6-chloro-2-oxospiro[1H-3,1-benzoxazine-4,4'-piperidine]-1'-yl)propyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | 6-chloro-3'-[3-(6-chloro-2-oxospiro[1H-3,1-benzoxazine-4,4'-piperidine]-1'-yl)propyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 10208637 |
| Molecular Formula | C26H26Cl2N4O4 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | 6-chloro-3'-[3-(6-chloro-2-oxospiro[1H-3,1-benzoxazine-4,4'-piperidine]-1'-yl)propyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1Nc2ccc(Cl)cc2C2(CCN(CCCN3C(=O)NC4(CCc5cc(Cl)ccc54)C3=O)CC2)O1 |
| InChI | InChI=1S/C26H26Cl2N4O4/c27-17-2-4-19-16(14-17)6-7-26(19)22(33)32(23(34)30-26)11-1-10-31-12-8-25(9-13-31)20-15-18(28)3-5-21(20)29-24(35)36-25/h2-5,14-15H,1,6-13H2,(H,29,35)(H,30,34) |
| InChIKey | YNWLPCYCIUQLKY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|