C18H22BrClN2O3 — CID 10025680
3'-(3-bromopropyl)-6-chloro-2,2-diethylspiro[3H-chromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 10025680) has the molecular formula C18H22BrClN2O3 and a molecular weight of 429.74 g/mol. Its IUPAC name is 3'-(3-bromopropyl)-6-chloro-2,2-diethylspiro[3H-chromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 3'-(3-bromopropyl)-6-chloro-2,2-diethylspiro[3H-chromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 10025680 |
| Molecular Formula | C18H22BrClN2O3 |
| Molecular Weight | 429.74 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 3'-(3-bromopropyl)-6-chloro-2,2-diethylspiro[3H-chromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | CCC1(CC)CC2(NC(=O)N(CCCBr)C2=O)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C18H22BrClN2O3/c1-3-17(4-2)11-18(13-10-12(20)6-7-14(13)25-17)15(23)22(9-5-8-19)16(24)21-18/h6-7,10H,3-5,8-9,11H2,1-2H3,(H,21,24) |
| InChIKey | OHAUSUBIXYHBFZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.74 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|