C17H12Cl3N3O2 — CID 167886126
6-chloro-3'-[(3,5-dichloro-2-pyridinyl)methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione (PubChem CID 167886126) has the molecular formula C17H12Cl3N3O2 and a molecular weight of 396.66 g/mol. Its IUPAC name is 6-chloro-3'-[(3,5-dichloro-2-pyridinyl)methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | 6-chloro-3'-[(3,5-dichloro-2-pyridinyl)methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 167886126 |
| Molecular Formula | C17H12Cl3N3O2 |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | 6-chloro-3'-[(3,5-dichloro-2-pyridinyl)methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC2(CCc3cc(Cl)ccc32)C(=O)N1Cc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C17H12Cl3N3O2/c18-10-1-2-12-9(5-10)3-4-17(12)15(24)23(16(25)22-17)8-14-13(20)6-11(19)7-21-14/h1-2,5-7H,3-4,8H2,(H,22,25) |
| InChIKey | WEFXFJJMYJOGHH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|