C20H29N3O5 — CID 102086588
(3R)-4-[(3aS,4S,6S,6aR)-4-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-3-azidobutan-1-ol (PubChem CID 102086588) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is (3R)-4-[(3aS,4S,6S,6aR)-4-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-3-azidobutan-1-ol.
| Compound Name | (3R)-4-[(3aS,4S,6S,6aR)-4-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-3-azidobutan-1-ol |
|---|---|
| PubChem CID | 102086588 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (3R)-4-[(3aS,4S,6S,6aR)-4-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-3-azidobutan-1-ol |
| SMILES | COc1ccc(CO[C@H]2C[C@H](C[C@H](CCO)N=[N+]=[N-])[C@H]3OC(C)(C)O[C@H]32)cc1 |
| InChI | InChI=1S/C20H29N3O5/c1-20(2)27-18-14(10-15(8-9-24)22-23-21)11-17(19(18)28-20)26-12-13-4-6-16(25-3)7-5-13/h4-7,14-15,17-19,24H,8-12H2,1-3H3/t14-,15-,17-,18+,19-/m0/s1 |
| InChIKey | BFKLSHJWBONHDL-JAQSECSASA-N |
| XLogP | 3.57 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|