About 2-hexyl-8-nitrofuro[3,2-c]cinnoline
2-hexyl-8-nitrofuro[3,2-c]cinnoline (PubChem CID 102087194) has the molecular formula C16H17N3O3
and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-hexyl-8-nitrofuro[3,2-c]cinnoline.
Molecular Properties
| Compound Name | 2-hexyl-8-nitrofuro[3,2-c]cinnoline |
| PubChem CID | 102087194 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-hexyl-8-nitrofuro[3,2-c]cinnoline |
| SMILES | CCCCCCc1cc2nnc3ccc([N+](=O)[O-])cc3c2o1 |
| InChI | InChI=1S/C16H17N3O3/c1-2-3-4-5-6-12-10-15-16(22-12)13-9-11(19(20)21)7-8-14(13)17-18-15/h7-10H,2-6H2,1H3 |
| InChIKey | MXRCVGDIXZYLNJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hexyl-8-nitrofuro[3,2-c]cinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexyl-8-nitrofuro[3,2-c]cinnoline?
The IUPAC name of 2-hexyl-8-nitrofuro[3,2-c]cinnoline (CID 102087194) is 2-hexyl-8-nitrofuro[3,2-c]cinnoline.
What is the SMILES notation for 2-hexyl-8-nitrofuro[3,2-c]cinnoline?
The canonical SMILES for 2-hexyl-8-nitrofuro[3,2-c]cinnoline is CCCCCCc1cc2nnc3ccc([N+](=O)[O-])cc3c2o1.
What is the InChIKey of 2-hexyl-8-nitrofuro[3,2-c]cinnoline?
The InChIKey is MXRCVGDIXZYLNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O3/c1-2-3-4-5-6-12-10-15-16(22-12)13-9-11(19(20)21)7-8-14(13)17-18-15/h7-10H,2-6H2,1H3.
What are the key properties of 2-hexyl-8-nitrofuro[3,2-c]cinnoline?
2-hexyl-8-nitrofuro[3,2-c]cinnoline has a molecular weight of 299.33 g/mol, XLogP of 4.41, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexyl-8-nitrofuro[3,2-c]cinnoline is sourced from PubChem (CID 102087194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).