About 6-bromo-8-methyl-2-octylfuro[3,2-c]cinnoline
6-bromo-8-methyl-2-octylfuro[3,2-c]cinnoline (PubChem CID 135053645) has the molecular formula C19H23BrN2O
and a molecular weight of 375.31 g/mol. Its IUPAC name is 6-bromo-8-methyl-2-octylfuro[3,2-c]cinnoline.
Molecular Properties
| Compound Name | 6-bromo-8-methyl-2-octylfuro[3,2-c]cinnoline |
| PubChem CID | 135053645 |
| Molecular Formula | C19H23BrN2O |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 6-bromo-8-methyl-2-octylfuro[3,2-c]cinnoline |
| SMILES | CCCCCCCCc1cc2nnc3c(Br)cc(C)cc3c2o1 |
| InChI | InChI=1S/C19H23BrN2O/c1-3-4-5-6-7-8-9-14-12-17-19(23-14)15-10-13(2)11-16(20)18(15)22-21-17/h10-12H,3-9H2,1-2H3 |
| InChIKey | HCUFWBCGTZXJCF-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-8-methyl-2-octylfuro[3,2-c]cinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-8-methyl-2-octylfuro[3,2-c]cinnoline?
The IUPAC name of 6-bromo-8-methyl-2-octylfuro[3,2-c]cinnoline (CID 135053645) is 6-bromo-8-methyl-2-octylfuro[3,2-c]cinnoline.
What is the SMILES notation for 6-bromo-8-methyl-2-octylfuro[3,2-c]cinnoline?
The canonical SMILES for 6-bromo-8-methyl-2-octylfuro[3,2-c]cinnoline is CCCCCCCCc1cc2nnc3c(Br)cc(C)cc3c2o1.
What is the InChIKey of 6-bromo-8-methyl-2-octylfuro[3,2-c]cinnoline?
The InChIKey is HCUFWBCGTZXJCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23BrN2O/c1-3-4-5-6-7-8-9-14-12-17-19(23-14)15-10-13(2)11-16(20)18(15)22-21-17/h10-12H,3-9H2,1-2H3.
What are the key properties of 6-bromo-8-methyl-2-octylfuro[3,2-c]cinnoline?
6-bromo-8-methyl-2-octylfuro[3,2-c]cinnoline has a molecular weight of 375.31 g/mol, XLogP of 6.35, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-8-methyl-2-octylfuro[3,2-c]cinnoline is sourced from PubChem (CID 135053645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).