C18H27NO — CID 102087759
N-ethyl-4-methoxy-2-[(2E,4E)-nona-2,4-dien-2-yl]aniline (PubChem CID 102087759) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is N-ethyl-4-methoxy-2-[(2E,4E)-nona-2,4-dien-2-yl]aniline.
| Compound Name | N-ethyl-4-methoxy-2-[(2E,4E)-nona-2,4-dien-2-yl]aniline |
|---|---|
| PubChem CID | 102087759 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | N-ethyl-4-methoxy-2-[(2E,4E)-nona-2,4-dien-2-yl]aniline |
| SMILES | CCCC/C=C/C=C(\C)c1cc(OC)ccc1NCC |
| InChI | InChI=1S/C18H27NO/c1-5-7-8-9-10-11-15(3)17-14-16(20-4)12-13-18(17)19-6-2/h9-14,19H,5-8H2,1-4H3/b10-9+,15-11+ |
| InChIKey | ZHDXRDRUAXYNAT-LVICEBGESA-N |
| XLogP | 5.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|