C37H40N2O4 — CID 102089245
(1',3',3'-trimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-9-yl) 4-octoxybenzoate (PubChem CID 102089245) has the molecular formula C37H40N2O4 and a molecular weight of 576.74 g/mol. Its IUPAC name is (1',3',3'-trimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-9-yl) 4-octoxybenzoate.
| Compound Name | (1',3',3'-trimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-9-yl) 4-octoxybenzoate |
|---|---|
| PubChem CID | 102089245 |
| Molecular Formula | C37H40N2O4 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.30 |
| IUPAC Name | (1',3',3'-trimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-9-yl) 4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc3ccc4c(c3c2)N=CC2(O4)N(C)c3ccccc3C2(C)C)cc1 |
| InChI | InChI=1S/C37H40N2O4/c1-5-6-7-8-9-12-23-41-28-19-16-27(17-20-28)35(40)42-29-21-15-26-18-22-33-34(30(26)24-29)38-25-37(43-33)36(2,3)31-13-10-11-14-32(31)39(37)4/h10-11,13-22,24-25H,5-9,12,23H2,1-4H3 |
| InChIKey | OQYPURWASOUIPI-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|