C35H44N2O5 — CID 12039437
ethyl 2-(1',3',3'-trimethyl-5'-nonoxyspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-9-yl)oxyacetate (PubChem CID 12039437) has the molecular formula C35H44N2O5 and a molecular weight of 572.75 g/mol. Its IUPAC name is ethyl 2-(1',3',3'-trimethyl-5'-nonoxyspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-9-yl)oxyacetate.
| Compound Name | ethyl 2-(1',3',3'-trimethyl-5'-nonoxyspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-9-yl)oxyacetate |
|---|---|
| PubChem CID | 12039437 |
| Molecular Formula | C35H44N2O5 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.33 |
| IUPAC Name | ethyl 2-(1',3',3'-trimethyl-5'-nonoxyspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-9-yl)oxyacetate |
| SMILES | CCCCCCCCCOc1ccc2c(c1)C(C)(C)C1(C=Nc3c(ccc4ccc(OCC(=O)OCC)cc34)O1)N2C |
| InChI | InChI=1S/C35H44N2O5/c1-6-8-9-10-11-12-13-20-40-27-17-18-30-29(22-27)34(3,4)35(37(30)5)24-36-33-28-21-26(41-23-32(38)39-7-2)16-14-25(28)15-19-31(33)42-35/h14-19,21-22,24H,6-13,20,23H2,1-5H3 |
| InChIKey | ODECOXXCKGMBSO-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|