C27H31N3O2 — CID 22372946
1-hexyl-5-methoxy-3,3-dimethylspiro[indole-2,3'-pyrido[3,4-f][1,4]benzoxazine] (PubChem CID 22372946) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 1-hexyl-5-methoxy-3,3-dimethylspiro[indole-2,3'-pyrido[3,4-f][1,4]benzoxazine].
| Compound Name | 1-hexyl-5-methoxy-3,3-dimethylspiro[indole-2,3'-pyrido[3,4-f][1,4]benzoxazine] |
|---|---|
| PubChem CID | 22372946 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 1-hexyl-5-methoxy-3,3-dimethylspiro[indole-2,3'-pyrido[3,4-f][1,4]benzoxazine] |
| SMILES | CCCCCCN1c2ccc(OC)cc2C(C)(C)C12C=Nc1c(ccc3ccncc13)O2 |
| InChI | InChI=1S/C27H31N3O2/c1-5-6-7-8-15-30-23-11-10-20(31-4)16-22(23)26(2,3)27(30)18-29-25-21-17-28-14-13-19(21)9-12-24(25)32-27/h9-14,16-18H,5-8,15H2,1-4H3 |
| InChIKey | XRNZSHCSKIHAHC-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 46.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|