C22H21N3O2 — CID 1206759
(2S)-5-methoxy-1,3,3-trimethylspiro[indole-2,3'-pyrido[3,2-f][1,4]benzoxazine] (PubChem CID 1206759) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is (2S)-5-methoxy-1,3,3-trimethylspiro[indole-2,3'-pyrido[3,2-f][1,4]benzoxazine].
| Compound Name | (2S)-5-methoxy-1,3,3-trimethylspiro[indole-2,3'-pyrido[3,2-f][1,4]benzoxazine] |
|---|---|
| PubChem CID | 1206759 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (2S)-5-methoxy-1,3,3-trimethylspiro[indole-2,3'-pyrido[3,2-f][1,4]benzoxazine] |
| SMILES | COc1ccc2c(c1)C(C)(C)[C@]1(C=Nc3c(ccc4ncccc34)O1)N2C |
| InChI | InChI=1S/C22H21N3O2/c1-21(2)16-12-14(26-4)7-9-18(16)25(3)22(21)13-24-20-15-6-5-11-23-17(15)8-10-19(20)27-22/h5-13H,1-4H3/t22-/m1/s1 |
| InChIKey | NZVCJXAYMCGZOB-JOCHJYFZSA-N |
| XLogP | 4.46 |
| TPSA | 46.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|