C15H21F3N+ — CID 102091143
trimethyl-[(E)-5-[4-(trifluoromethyl)phenyl]pent-4-enyl]azanium (PubChem CID 102091143) has the molecular formula C15H21F3N+ and a molecular weight of 272.33 g/mol. Its IUPAC name is trimethyl-[(E)-5-[4-(trifluoromethyl)phenyl]pent-4-enyl]azanium.
| Compound Name | trimethyl-[(E)-5-[4-(trifluoromethyl)phenyl]pent-4-enyl]azanium |
|---|---|
| PubChem CID | 102091143 |
| Molecular Formula | C15H21F3N+ |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | trimethyl-[(E)-5-[4-(trifluoromethyl)phenyl]pent-4-enyl]azanium |
| SMILES | C[N+](C)(C)CCC/C=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H21F3N/c1-19(2,3)12-6-4-5-7-13-8-10-14(11-9-13)15(16,17)18/h5,7-11H,4,6,12H2,1-3H3/q+1/b7-5+ |
| InChIKey | JDHWUPFCAUSUPL-FNORWQNLSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|