C18H30O4Si — CID 102092268
tert-butyl-[[(1R,2R,6S,8R,9S)-3-ethenyl-12-methylidene-5,7,10-trioxatricyclo[7.3.0.02,6]dodecan-8-yl]oxy]-dimethylsilane (PubChem CID 102092268) has the molecular formula C18H30O4Si and a molecular weight of 338.52 g/mol. Its IUPAC name is tert-butyl-[[(1R,2R,6S,8R,9S)-3-ethenyl-12-methylidene-5,7,10-trioxatricyclo[7.3.0.02,6]dodecan-8-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,2R,6S,8R,9S)-3-ethenyl-12-methylidene-5,7,10-trioxatricyclo[7.3.0.02,6]dodecan-8-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 102092268 |
| Molecular Formula | C18H30O4Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | tert-butyl-[[(1R,2R,6S,8R,9S)-3-ethenyl-12-methylidene-5,7,10-trioxatricyclo[7.3.0.02,6]dodecan-8-yl]oxy]-dimethylsilane |
| SMILES | C=CC1CO[C@H]2O[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3OCC(=C)[C@H]3[C@@H]12 |
| InChI | InChI=1S/C18H30O4Si/c1-8-12-10-20-16-14(12)13-11(2)9-19-15(13)17(21-16)22-23(6,7)18(3,4)5/h8,12-17H,1-2,9-10H2,3-7H3/t12?,13-,14+,15-,16-,17+/m0/s1 |
| InChIKey | HQVJZJGFSYADAU-HUESISHMSA-N |
| XLogP | 3.71 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|