C10H16O5 — CID 102092361
(4aR,8S,8aS)-4a-methoxy-2,2-dimethyl-8,8a-dihydro-4H-pyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 102092361) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is (4aR,8S,8aS)-4a-methoxy-2,2-dimethyl-8,8a-dihydro-4H-pyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (4aR,8S,8aS)-4a-methoxy-2,2-dimethyl-8,8a-dihydro-4H-pyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 102092361 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | (4aR,8S,8aS)-4a-methoxy-2,2-dimethyl-8,8a-dihydro-4H-pyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | CO[C@@]12COC(C)(C)O[C@H]1[C@@H](O)C=CO2 |
| InChI | InChI=1S/C10H16O5/c1-9(2)14-6-10(12-3)8(15-9)7(11)4-5-13-10/h4-5,7-8,11H,6H2,1-3H3/t7-,8-,10+/m0/s1 |
| InChIKey | DEIKOBZINPHQJO-OYNCUSHFSA-N |
| XLogP | 0.39 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |