C9H12O4 — CID 102385498
(3aR,6S,6aS)-6-hydroxy-2,2-dimethyl-6,6a-dihydrocyclopenta[d][1,3]dioxole-3a-carbaldehyde (PubChem CID 102385498) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is (3aR,6S,6aS)-6-hydroxy-2,2-dimethyl-6,6a-dihydrocyclopenta[d][1,3]dioxole-3a-carbaldehyde.
| Compound Name | (3aR,6S,6aS)-6-hydroxy-2,2-dimethyl-6,6a-dihydrocyclopenta[d][1,3]dioxole-3a-carbaldehyde |
|---|---|
| PubChem CID | 102385498 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (3aR,6S,6aS)-6-hydroxy-2,2-dimethyl-6,6a-dihydrocyclopenta[d][1,3]dioxole-3a-carbaldehyde |
| SMILES | CC1(C)O[C@H]2[C@@H](O)C=C[C@@]2(C=O)O1 |
| InChI | InChI=1S/C9H12O4/c1-8(2)12-7-6(11)3-4-9(7,5-10)13-8/h3-7,11H,1-2H3/t6-,7-,9-/m0/s1 |
| InChIKey | OHYQUAGRIPJBKB-ZKWXMUAHSA-N |
| XLogP | 0.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|