C10H15BrO3 — CID 53388455
[(3aR,7aS)-7-bromo-2,2-dimethyl-7,7a-dihydro-6H-1,3-benzodioxol-3a-yl]methanol (PubChem CID 53388455) has the molecular formula C10H15BrO3 and a molecular weight of 263.13 g/mol. Its IUPAC name is [(3aR,7aS)-7-bromo-2,2-dimethyl-7,7a-dihydro-6H-1,3-benzodioxol-3a-yl]methanol.
| Compound Name | [(3aR,7aS)-7-bromo-2,2-dimethyl-7,7a-dihydro-6H-1,3-benzodioxol-3a-yl]methanol |
|---|---|
| PubChem CID | 53388455 |
| Molecular Formula | C10H15BrO3 |
| Molecular Weight | 263.13 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | [(3aR,7aS)-7-bromo-2,2-dimethyl-7,7a-dihydro-6H-1,3-benzodioxol-3a-yl]methanol |
| SMILES | CC1(C)O[C@@H]2C(Br)CC=C[C@]2(CO)O1 |
| InChI | InChI=1S/C10H15BrO3/c1-9(2)13-8-7(11)4-3-5-10(8,6-12)14-9/h3,5,7-8,12H,4,6H2,1-2H3/t7?,8-,10-/m1/s1 |
| InChIKey | IKRPKIILYVQDLR-JDOFKEMOSA-N |
| XLogP | 1.59 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.13 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|