C7H13BrO3 — CID 101084136
(3S,4R,5S)-4-bromo-5-(hydroxymethyl)-3,5-dimethyloxolan-2-ol (PubChem CID 101084136) has the molecular formula C7H13BrO3 and a molecular weight of 225.08 g/mol. Its IUPAC name is (3S,4R,5S)-4-bromo-5-(hydroxymethyl)-3,5-dimethyloxolan-2-ol.
| Compound Name | (3S,4R,5S)-4-bromo-5-(hydroxymethyl)-3,5-dimethyloxolan-2-ol |
|---|---|
| PubChem CID | 101084136 |
| Molecular Formula | C7H13BrO3 |
| Molecular Weight | 225.08 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | (3S,4R,5S)-4-bromo-5-(hydroxymethyl)-3,5-dimethyloxolan-2-ol |
| SMILES | C[C@H]1C(O)O[C@@](C)(CO)[C@@H]1Br |
| InChI | InChI=1S/C7H13BrO3/c1-4-5(8)7(2,3-9)11-6(4)10/h4-6,9-10H,3H2,1-2H3/t4-,5-,6?,7+/m1/s1 |
| InChIKey | APQRIZMIQPIUJE-FYBJJZIISA-N |
| XLogP | 0.49 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.08 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|