C7H14O7 — CID 57122602
(2S,3S,5S,6R)-6-(hydroxymethyl)-6-methyloxane-2,3,4,4,5-pentol (PubChem CID 57122602) has the molecular formula C7H14O7 and a molecular weight of 210.18 g/mol. Its IUPAC name is (2S,3S,5S,6R)-6-(hydroxymethyl)-6-methyloxane-2,3,4,4,5-pentol.
| Compound Name | (2S,3S,5S,6R)-6-(hydroxymethyl)-6-methyloxane-2,3,4,4,5-pentol |
|---|---|
| PubChem CID | 57122602 |
| Molecular Formula | C7H14O7 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | (2S,3S,5S,6R)-6-(hydroxymethyl)-6-methyloxane-2,3,4,4,5-pentol |
| SMILES | C[C@]1(CO)O[C@H](O)[C@H](O)C(O)(O)[C@H]1O |
| InChI | InChI=1S/C7H14O7/c1-6(2-8)5(11)7(12,13)3(9)4(10)14-6/h3-5,8-13H,2H2,1H3/t3-,4-,5-,6+/m0/s1 |
| InChIKey | HLVDDIHXYGELMY-OMMKOOBNSA-N |
| XLogP | -3.51 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|