C7H14O8 — CID 139891188
(2S,3R,5R,6S)-6-(dihydroxymethyl)-2-methyloxane-2,3,4,4,5-pentol (PubChem CID 139891188) has the molecular formula C7H14O8 and a molecular weight of 226.18 g/mol. Its IUPAC name is (2S,3R,5R,6S)-6-(dihydroxymethyl)-2-methyloxane-2,3,4,4,5-pentol.
| Compound Name | (2S,3R,5R,6S)-6-(dihydroxymethyl)-2-methyloxane-2,3,4,4,5-pentol |
|---|---|
| PubChem CID | 139891188 |
| Molecular Formula | C7H14O8 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | (2S,3R,5R,6S)-6-(dihydroxymethyl)-2-methyloxane-2,3,4,4,5-pentol |
| SMILES | C[C@]1(O)O[C@H](C(O)O)[C@@H](O)C(O)(O)[C@H]1O |
| InChI | InChI=1S/C7H14O8/c1-6(12)5(11)7(13,14)3(8)2(15-6)4(9)10/h2-5,8-14H,1H3/t2-,3+,5-,6-/m0/s1 |
| InChIKey | FVNOZYNFURSMBN-VPXOEYFHSA-N |
| XLogP | -4.19 |
| TPSA | 150.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | -4.19 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|