C16H26O8 — CID 25099103
(1S,2S,7S,10R,12R,13R)-7-hydroxy-12,13-dimethoxy-4,4,12,13-tetramethyl-3,5,11,14-tetraoxatricyclo[8.4.0.02,7]tetradecan-9-one (PubChem CID 25099103) has the molecular formula C16H26O8 and a molecular weight of 346.38 g/mol. Its IUPAC name is (1S,2S,7S,10R,12R,13R)-7-hydroxy-12,13-dimethoxy-4,4,12,13-tetramethyl-3,5,11,14-tetraoxatricyclo[8.4.0.02,7]tetradecan-9-one.
| Compound Name | (1S,2S,7S,10R,12R,13R)-7-hydroxy-12,13-dimethoxy-4,4,12,13-tetramethyl-3,5,11,14-tetraoxatricyclo[8.4.0.02,7]tetradecan-9-one |
|---|---|
| PubChem CID | 25099103 |
| Molecular Formula | C16H26O8 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (1S,2S,7S,10R,12R,13R)-7-hydroxy-12,13-dimethoxy-4,4,12,13-tetramethyl-3,5,11,14-tetraoxatricyclo[8.4.0.02,7]tetradecan-9-one |
| SMILES | CO[C@]1(C)O[C@@H]2[C@@H](O[C@@]1(C)OC)C(=O)C[C@]1(O)COC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C16H26O8/c1-13(2)21-8-16(18)7-9(17)10-11(12(16)24-13)23-15(4,20-6)14(3,19-5)22-10/h10-12,18H,7-8H2,1-6H3/t10-,11+,12-,14+,15+,16-/m0/s1 |
| InChIKey | UKRFWXQMXPIMBZ-RJUOPTFYSA-N |
| XLogP | 0.35 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |